C11H14Cl2N2O2 — CID 82358493
N-(2,5-dichlorophenyl)-2-(2-hydroxyethylamino)propanamide (PubChem CID 82358493) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(2-hydroxyethylamino)propanamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(2-hydroxyethylamino)propanamide |
|---|---|
| PubChem CID | 82358493 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(2-hydroxyethylamino)propanamide |
| SMILES | CC(NCCO)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O2/c1-7(14-4-5-16)11(17)15-10-6-8(12)2-3-9(10)13/h2-3,6-7,14,16H,4-5H2,1H3,(H,15,17) |
| InChIKey | KKAHQHBLZFNOBO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |