C8H5Cl3FNO — CID 44519506
2,2-dichloro-N-(5-chloro-2-fluorophenyl)acetamide (PubChem CID 44519506) has the molecular formula C8H5Cl3FNO and a molecular weight of 256.49 g/mol. Its IUPAC name is 2,2-dichloro-N-(5-chloro-2-fluorophenyl)acetamide.
| Compound Name | 2,2-dichloro-N-(5-chloro-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 44519506 |
| Molecular Formula | C8H5Cl3FNO |
| Molecular Weight | 256.49 g/mol |
| Exact Mass | 254.94 |
| IUPAC Name | 2,2-dichloro-N-(5-chloro-2-fluorophenyl)acetamide |
| SMILES | O=C(Nc1cc(Cl)ccc1F)C(Cl)Cl |
| InChI | InChI=1S/C8H5Cl3FNO/c9-4-1-2-5(12)6(3-4)13-8(14)7(10)11/h1-3,7H,(H,13,14) |
| InChIKey | LZYJIZSHSBCVKH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|