C8H8F2N2S — CID 8668955
1-(2,5-difluorophenyl)-3-methylthiourea (PubChem CID 8668955) has the molecular formula C8H8F2N2S and a molecular weight of 202.23 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-methylthiourea.
| Compound Name | 1-(2,5-difluorophenyl)-3-methylthiourea |
|---|---|
| PubChem CID | 8668955 |
| Molecular Formula | C8H8F2N2S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-methylthiourea |
| SMILES | CNC(=S)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C8H8F2N2S/c1-11-8(13)12-7-4-5(9)2-3-6(7)10/h2-4H,1H3,(H2,11,12,13) |
| InChIKey | HFEACDBSHFXSJW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|