C13H10F2N2S — CID 17263148
1-(2,5-difluorophenyl)-3-phenylthiourea (PubChem CID 17263148) has the molecular formula C13H10F2N2S and a molecular weight of 264.30 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-phenylthiourea.
| Compound Name | 1-(2,5-difluorophenyl)-3-phenylthiourea |
|---|---|
| PubChem CID | 17263148 |
| Molecular Formula | C13H10F2N2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-phenylthiourea |
| SMILES | Fc1ccc(F)c(NC(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C13H10F2N2S/c14-9-6-7-11(15)12(8-9)17-13(18)16-10-4-2-1-3-5-10/h1-8H,(H2,16,17,18) |
| InChIKey | FRUSMLJKXIZXHE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|