C13H9BrF2N2S — CID 683119
1-(4-bromophenyl)-3-(2,4-difluorophenyl)thiourea (PubChem CID 683119) has the molecular formula C13H9BrF2N2S and a molecular weight of 343.20 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(2,4-difluorophenyl)thiourea.
| Compound Name | 1-(4-bromophenyl)-3-(2,4-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 683119 |
| Molecular Formula | C13H9BrF2N2S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 1-(4-bromophenyl)-3-(2,4-difluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2ccc(Br)cc2)c(F)c1 |
| InChI | InChI=1S/C13H9BrF2N2S/c14-8-1-4-10(5-2-8)17-13(19)18-12-6-3-9(15)7-11(12)16/h1-7H,(H2,17,18,19) |
| InChIKey | NVJGYQWFOMRRPT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|