C16H16F2N2O3S — CID 19678005
1-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 19678005) has the molecular formula C16H16F2N2O3S and a molecular weight of 354.38 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19678005 |
| Molecular Formula | C16H16F2N2O3S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)Nc2ccc(F)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C16H16F2N2O3S/c1-21-13-7-10(8-14(22-2)15(13)23-3)19-16(24)20-12-5-4-9(17)6-11(12)18/h4-8H,1-3H3,(H2,19,20,24) |
| InChIKey | HHIHYAYUROSLBF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|