C10H14N2O3S — CID 2760811
(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 2760811) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | (3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2760811 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(N)=S)cc(OC)c1OC |
| InChI | InChI=1S/C10H14N2O3S/c1-13-7-4-6(12-10(11)16)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H3,11,12,16) |
| InChIKey | ZHVXETDHOROSGO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|