C17H19NO4S — CID 139928461
O-benzyl N-(3,4,5-trimethoxyphenyl)carbamothioate (PubChem CID 139928461) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is O-benzyl N-(3,4,5-trimethoxyphenyl)carbamothioate.
| Compound Name | O-benzyl N-(3,4,5-trimethoxyphenyl)carbamothioate |
|---|---|
| PubChem CID | 139928461 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | O-benzyl N-(3,4,5-trimethoxyphenyl)carbamothioate |
| SMILES | COc1cc(NC(=S)OCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO4S/c1-19-14-9-13(10-15(20-2)16(14)21-3)18-17(23)22-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,18,23) |
| InChIKey | HKOKSFPVHJSHLA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|