C19H15F2N3O2S2 — CID 25237672
1-(2,4-difluorophenyl)-3-[4-(phenylsulfamoyl)phenyl]thiourea (PubChem CID 25237672) has the molecular formula C19H15F2N3O2S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[4-(phenylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[4-(phenylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 25237672 |
| Molecular Formula | C19H15F2N3O2S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[4-(phenylsulfamoyl)phenyl]thiourea |
| SMILES | O=S(=O)(Nc1ccccc1)c1ccc(NC(=S)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H15F2N3O2S2/c20-13-6-11-18(17(21)12-13)23-19(27)22-14-7-9-16(10-8-14)28(25,26)24-15-4-2-1-3-5-15/h1-12,24H,(H2,22,23,27) |
| InChIKey | PSTMMXGDGVBGPU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|