C20H18FN3O2S2 — CID 19678720
1-(3-fluorophenyl)-3-[4-[(2-methylphenyl)sulfamoyl]phenyl]thiourea (PubChem CID 19678720) has the molecular formula C20H18FN3O2S2 and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[4-[(2-methylphenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(3-fluorophenyl)-3-[4-[(2-methylphenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 19678720 |
| Molecular Formula | C20H18FN3O2S2 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[4-[(2-methylphenyl)sulfamoyl]phenyl]thiourea |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(NC(=S)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H18FN3O2S2/c1-14-5-2-3-8-19(14)24-28(25,26)18-11-9-16(10-12-18)22-20(27)23-17-7-4-6-15(21)13-17/h2-13,24H,1H3,(H2,22,23,27) |
| InChIKey | VRPQASNGYZSMRV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|