C20H20N4O4S3 — CID 19678782
1-[4-[(2-methylphenyl)sulfamoyl]phenyl]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 19678782) has the molecular formula C20H20N4O4S3 and a molecular weight of 476.61 g/mol. Its IUPAC name is 1-[4-[(2-methylphenyl)sulfamoyl]phenyl]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[4-[(2-methylphenyl)sulfamoyl]phenyl]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 19678782 |
| Molecular Formula | C20H20N4O4S3 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 1-[4-[(2-methylphenyl)sulfamoyl]phenyl]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(NC(=S)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H20N4O4S3/c1-14-4-2-3-5-19(14)24-31(27,28)18-12-8-16(9-13-18)23-20(29)22-15-6-10-17(11-7-15)30(21,25)26/h2-13,24H,1H3,(H2,21,25,26)(H2,22,23,29) |
| InChIKey | HNDNZLGRFGOTGD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|