C13H8Cl2F2N2S — CID 17381854
1-(2,3-dichlorophenyl)-3-(2,5-difluorophenyl)thiourea (PubChem CID 17381854) has the molecular formula C13H8Cl2F2N2S and a molecular weight of 333.19 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(2,5-difluorophenyl)thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(2,5-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 17381854 |
| Molecular Formula | C13H8Cl2F2N2S |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(2,5-difluorophenyl)thiourea |
| SMILES | Fc1ccc(F)c(NC(=S)Nc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H8Cl2F2N2S/c14-8-2-1-3-10(12(8)15)18-13(20)19-11-6-7(16)4-5-9(11)17/h1-6H,(H2,18,19,20) |
| InChIKey | BHRDYPLXYMUESF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|