C8H9F2N3S — CID 8657917
1-(2,4-difluoroanilino)-3-methylthiourea (PubChem CID 8657917) has the molecular formula C8H9F2N3S and a molecular weight of 217.24 g/mol. Its IUPAC name is 1-(2,4-difluoroanilino)-3-methylthiourea.
| Compound Name | 1-(2,4-difluoroanilino)-3-methylthiourea |
|---|---|
| PubChem CID | 8657917 |
| Molecular Formula | C8H9F2N3S |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 1-(2,4-difluoroanilino)-3-methylthiourea |
| SMILES | CNC(=S)NNc1ccc(F)cc1F |
| InChI | InChI=1S/C8H9F2N3S/c1-11-8(14)13-12-7-3-2-5(9)4-6(7)10/h2-4,12H,1H3,(H2,11,13,14) |
| InChIKey | XWQSOYNWYBWXKQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|