C15H15F2N3OS — CID 7942306
1-(2,4-difluoroanilino)-3-(4-ethoxyphenyl)thiourea (PubChem CID 7942306) has the molecular formula C15H15F2N3OS and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-(2,4-difluoroanilino)-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-(2,4-difluoroanilino)-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 7942306 |
| Molecular Formula | C15H15F2N3OS |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-(2,4-difluoroanilino)-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)NNc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H15F2N3OS/c1-2-21-12-6-4-11(5-7-12)18-15(22)20-19-14-8-3-10(16)9-13(14)17/h3-9,19H,2H2,1H3,(H2,18,20,22) |
| InChIKey | PVBAAEUBOVFHJG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|