C15H13Br2FN2OS — CID 19679840
1-(2,4-dibromo-6-fluorophenyl)-3-(4-ethoxyphenyl)thiourea (PubChem CID 19679840) has the molecular formula C15H13Br2FN2OS and a molecular weight of 448.16 g/mol. Its IUPAC name is 1-(2,4-dibromo-6-fluorophenyl)-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-(2,4-dibromo-6-fluorophenyl)-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19679840 |
| Molecular Formula | C15H13Br2FN2OS |
| Molecular Weight | 448.16 g/mol |
| Exact Mass | 445.91 |
| IUPAC Name | 1-(2,4-dibromo-6-fluorophenyl)-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)Nc2c(F)cc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C15H13Br2FN2OS/c1-2-21-11-5-3-10(4-6-11)19-15(22)20-14-12(17)7-9(16)8-13(14)18/h3-8H,2H2,1H3,(H2,19,20,22) |
| InChIKey | CBCSLMKPOXUKIZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.16 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|