C13H19F2N4OS+ — CID 8657931
1-(2,4-difluoroanilino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8657931) has the molecular formula C13H19F2N4OS+ and a molecular weight of 317.38 g/mol. Its IUPAC name is 1-(2,4-difluoroanilino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(2,4-difluoroanilino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8657931 |
| Molecular Formula | C13H19F2N4OS+ |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-(2,4-difluoroanilino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | Fc1ccc(NNC(=S)NCC[NH+]2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C13H18F2N4OS/c14-10-1-2-12(11(15)9-10)17-18-13(21)16-3-4-19-5-7-20-8-6-19/h1-2,9,17H,3-8H2,(H2,16,18,21)/p+1 |
| InChIKey | LJNSFEBXHCXKPH-UHFFFAOYSA-O |
| XLogP | -0.33 |
| TPSA | 49.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|