C15H21N6OS+ — CID 2396010
1-(2-morpholin-4-ium-4-ylethyl)-3-(phthalazin-1-ylamino)thiourea (PubChem CID 2396010) has the molecular formula C15H21N6OS+ and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-(2-morpholin-4-ium-4-ylethyl)-3-(phthalazin-1-ylamino)thiourea.
| Compound Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-(phthalazin-1-ylamino)thiourea |
|---|---|
| PubChem CID | 2396010 |
| Molecular Formula | C15H21N6OS+ |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-(phthalazin-1-ylamino)thiourea |
| SMILES | S=C(NCC[NH+]1CCOCC1)NNc1nncc2ccccc12 |
| InChI | InChI=1S/C15H20N6OS/c23-15(16-5-6-21-7-9-22-10-8-21)20-19-14-13-4-2-1-3-12(13)11-17-18-14/h1-4,11H,5-10H2,(H,18,19)(H2,16,20,23)/p+1 |
| InChIKey | NIWLBNNDCOMGCT-UHFFFAOYSA-O |
| XLogP | -0.66 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|