C20H27N4O3S+ — CID 8767625
1-(2-morpholin-4-ium-4-ylethyl)-3-[[(2R)-2-naphthalen-2-yloxypropanoyl]amino]thiourea (PubChem CID 8767625) has the molecular formula C20H27N4O3S+ and a molecular weight of 403.53 g/mol. Its IUPAC name is 1-(2-morpholin-4-ium-4-ylethyl)-3-[[(2R)-2-naphthalen-2-yloxypropanoyl]amino]thiourea.
| Compound Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-[[(2R)-2-naphthalen-2-yloxypropanoyl]amino]thiourea |
|---|---|
| PubChem CID | 8767625 |
| Molecular Formula | C20H27N4O3S+ |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-[[(2R)-2-naphthalen-2-yloxypropanoyl]amino]thiourea |
| SMILES | C[C@@H](Oc1ccc2ccccc2c1)C(=O)NNC(=S)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H26N4O3S/c1-15(27-18-7-6-16-4-2-3-5-17(16)14-18)19(25)22-23-20(28)21-8-9-24-10-12-26-13-11-24/h2-7,14-15H,8-13H2,1H3,(H,22,25)(H2,21,23,28)/p+1/t15-/m1/s1 |
| InChIKey | BTYDBGLXDGVBMD-OAHLLOKOSA-O |
| XLogP | 0.02 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|