C18H29N4O4S+ — CID 8768103
1-[[(2S)-2-(4-ethoxyphenoxy)propanoyl]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8768103) has the molecular formula C18H29N4O4S+ and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[[(2S)-2-(4-ethoxyphenoxy)propanoyl]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[[(2S)-2-(4-ethoxyphenoxy)propanoyl]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8768103 |
| Molecular Formula | C18H29N4O4S+ |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-[[(2S)-2-(4-ethoxyphenoxy)propanoyl]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | CCOc1ccc(O[C@@H](C)C(=O)NNC(=S)NCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C18H28N4O4S/c1-3-25-15-4-6-16(7-5-15)26-14(2)17(23)20-21-18(27)19-8-9-22-10-12-24-13-11-22/h4-7,14H,3,8-13H2,1-2H3,(H,20,23)(H2,19,21,27)/p+1/t14-/m0/s1 |
| InChIKey | IMFIUZLYZBLOTJ-AWEZNQCLSA-O |
| XLogP | -0.74 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|