C16H24F2N3O2S+ — CID 9283612
1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 9283612) has the molecular formula C16H24F2N3O2S+ and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 9283612 |
| Molecular Formula | C16H24F2N3O2S+ |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | FC(F)Oc1ccc(CCNC(=S)NCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C16H23F2N3O2S/c17-15(18)23-14-3-1-13(2-4-14)5-6-19-16(24)20-7-8-21-9-11-22-12-10-21/h1-4,15H,5-12H2,(H2,19,20,24)/p+1 |
| InChIKey | ZGWVQJFVMGSGDW-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|