C17H24F2N2OS — CID 9283623
1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[(1R,2R)-2-methylcyclohexyl]thiourea (PubChem CID 9283623) has the molecular formula C17H24F2N2OS and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[(1R,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 9283623 |
| Molecular Formula | C17H24F2N2OS |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=S)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H24F2N2OS/c1-12-4-2-3-5-15(12)21-17(23)20-11-10-13-6-8-14(9-7-13)22-16(18)19/h6-9,12,15-16H,2-5,10-11H2,1H3,(H2,20,21,23)/t12-,15-/m1/s1 |
| InChIKey | CWKQCIALZFGLMV-IUODEOHRSA-N |
| XLogP | 3.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|