C17H24F2N2O2S — CID 9096186
1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-[(1S,2S)-2-methylcyclohexyl]thiourea (PubChem CID 9096186) has the molecular formula C17H24F2N2O2S and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-[(1S,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-[(1S,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 9096186 |
| Molecular Formula | C17H24F2N2O2S |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-[(1S,2S)-2-methylcyclohexyl]thiourea |
| SMILES | COc1cc(CNC(=S)N[C@H]2CCCC[C@@H]2C)ccc1OC(F)F |
| InChI | InChI=1S/C17H24F2N2O2S/c1-11-5-3-4-6-13(11)21-17(24)20-10-12-7-8-14(23-16(18)19)15(9-12)22-2/h7-9,11,13,16H,3-6,10H2,1-2H3,(H2,20,21,24)/t11-,13-/m0/s1 |
| InChIKey | GZSAXVVDAIZYSL-AAEUAGOBSA-N |
| XLogP | 3.84 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|