C16H22F2N2O4 — CID 95329456
(3S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-methoxypiperidine-1-carboxamide (PubChem CID 95329456) has the molecular formula C16H22F2N2O4 and a molecular weight of 344.36 g/mol. Its IUPAC name is (3S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-methoxypiperidine-1-carboxamide.
| Compound Name | (3S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-methoxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 95329456 |
| Molecular Formula | C16H22F2N2O4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (3S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-methoxypiperidine-1-carboxamide |
| SMILES | COc1cc(CNC(=O)N2CCC[C@H](OC)C2)ccc1OC(F)F |
| InChI | InChI=1S/C16H22F2N2O4/c1-22-12-4-3-7-20(10-12)16(21)19-9-11-5-6-13(24-15(17)18)14(8-11)23-2/h5-6,8,12,15H,3-4,7,9-10H2,1-2H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | LGNBCDRLCSZAAU-LBPRGKRZSA-N |
| XLogP | 2.62 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |