C19H28F2IN3O4 — CID 110993108
ethyl 1-[N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993108) has the molecular formula C19H28F2IN3O4 and a molecular weight of 527.35 g/mol. Its IUPAC name is ethyl 1-[N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993108 |
| Molecular Formula | C19H28F2IN3O4 |
| Molecular Weight | 527.35 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | ethyl 1-[N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N\C)NCc2ccc(OC)c(OC(F)F)c2)C1.I |
| InChI | InChI=1S/C19H27F2N3O4.HI/c1-4-27-17(25)14-6-5-9-24(12-14)19(22-2)23-11-13-7-8-15(26-3)16(10-13)28-18(20)21;/h7-8,10,14,18H,4-6,9,11-12H2,1-3H3,(H,22,23);1H |
| InChIKey | PNBHAJUUISNLKS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|