C20H29F2IN4O4 — CID 111301126
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111301126) has the molecular formula C20H29F2IN4O4 and a molecular weight of 554.38 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111301126 |
| Molecular Formula | C20H29F2IN4O4 |
| Molecular Weight | 554.38 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC(F)F)c1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C20H28F2N4O4.HI/c1-23-20(24-13-14-5-6-15(28-2)17(12-14)30-19(21)22)26-9-7-25(8-10-26)18(27)16-4-3-11-29-16;/h5-6,12,16,19H,3-4,7-11,13H2,1-2H3,(H,23,24);1H |
| InChIKey | HZTHBYFFZHBACH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|