C23H37IN4O4 — CID 111301616
N-[2-(3,4-diethoxyphenyl)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111301616) has the molecular formula C23H37IN4O4 and a molecular weight of 560.48 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111301616 |
| Molecular Formula | C23H37IN4O4 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOc1ccc(CCN/C(=N/C)N2CCN(C(=O)C3CCCO3)CC2)cc1OCC.I |
| InChI | InChI=1S/C23H36N4O4.HI/c1-4-29-19-9-8-18(17-21(19)30-5-2)10-11-25-23(24-3)27-14-12-26(13-15-27)22(28)20-7-6-16-31-20;/h8-9,17,20H,4-7,10-16H2,1-3H3,(H,24,25);1H |
| InChIKey | LXKLMYKTJGXTSF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|