C20H34IN3O2 — CID 111143735
N-[2-(3,4-diethoxyphenyl)ethyl]-N',3-dimethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111143735) has the molecular formula C20H34IN3O2 and a molecular weight of 475.42 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-N',3-dimethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N',3-dimethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111143735 |
| Molecular Formula | C20H34IN3O2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N',3-dimethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOc1ccc(CCN/C(=N/C)N2CCCC(C)C2)cc1OCC.I |
| InChI | InChI=1S/C20H33N3O2.HI/c1-5-24-18-10-9-17(14-19(18)25-6-2)11-12-22-20(21-4)23-13-7-8-16(3)15-23;/h9-10,14,16H,5-8,11-13,15H2,1-4H3,(H,21,22);1H |
| InChIKey | PINIVMXZXLRMKR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|