C17H26IN3O2 — CID 111145905
N-[2-(1,3-benzodioxol-5-yl)ethyl]-N',3-dimethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111145905) has the molecular formula C17H26IN3O2 and a molecular weight of 431.32 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-N',3-dimethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-N',3-dimethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111145905 |
| Molecular Formula | C17H26IN3O2 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-N',3-dimethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCO2)N1CCCC(C)C1.I |
| InChI | InChI=1S/C17H25N3O2.HI/c1-13-4-3-9-20(11-13)17(18-2)19-8-7-14-5-6-15-16(10-14)22-12-21-15;/h5-6,10,13H,3-4,7-9,11-12H2,1-2H3,(H,18,19);1H |
| InChIKey | XYKNBLZNZMTHBL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|