C18H27N3O2 — CID 111256765
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine (PubChem CID 111256765) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 111256765 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine |
| SMILES | C/N=C(\NCCc1ccc2c(c1)OCO2)NC1CCC(C)CC1 |
| InChI | InChI=1S/C18H27N3O2/c1-13-3-6-15(7-4-13)21-18(19-2)20-10-9-14-5-8-16-17(11-14)23-12-22-16/h5,8,11,13,15H,3-4,6-7,9-10,12H2,1-2H3,(H2,19,20,21) |
| InChIKey | PRQFADOKGIBRAG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|