C19H28N4O4 — CID 109465358
tert-butyl 3-[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465358) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is tert-butyl 3-[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465358 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | tert-butyl 3-[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCCc1ccc2c(c1)OCO2)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H28N4O4/c1-19(2,3)27-18(24)23-10-14(11-23)22-17(20-4)21-8-7-13-5-6-15-16(9-13)26-12-25-15/h5-6,9,14H,7-8,10-12H2,1-4H3,(H2,20,21,22) |
| InChIKey | DDDOWVBZNSVTHF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|