C22H35IN4O4 — CID 111380392
tert-butyl 3-[[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111380392) has the molecular formula C22H35IN4O4 and a molecular weight of 546.45 g/mol. Its IUPAC name is tert-butyl 3-[[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111380392 |
| Molecular Formula | C22H35IN4O4 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | tert-butyl 3-[[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCO2)NCC1CCCN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C22H34N4O4.HI/c1-22(2,3)30-21(27)26-11-5-6-17(14-26)13-25-20(23-4)24-10-9-16-7-8-18-19(12-16)29-15-28-18;/h7-8,12,17H,5-6,9-11,13-15H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | HVCXKHSNTLUNGH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|