C22H37IN4O3 — CID 111799539
tert-butyl 3-[2-[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111799539) has the molecular formula C22H37IN4O3 and a molecular weight of 532.47 g/mol. Its IUPAC name is tert-butyl 3-[2-[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[2-[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111799539 |
| Molecular Formula | C22H37IN4O3 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | tert-butyl 3-[2-[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCCC1CCCN(C(=O)OC(C)(C)C)C1)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C22H36N4O3.HI/c1-22(2,3)29-21(27)26-14-6-7-18(16-26)12-13-24-20(23-4)25-15-17-8-10-19(28-5)11-9-17;/h8-11,18H,6-7,12-16H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | FIJFTSQGXLIIOQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|