C19H31N5O4S — CID 109465346
tert-butyl 3-[[N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465346) has the molecular formula C19H31N5O4S and a molecular weight of 425.56 g/mol. Its IUPAC name is tert-butyl 3-[[N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465346 |
| Molecular Formula | C19H31N5O4S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | tert-butyl 3-[[N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N(C)C)cc1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H31N5O4S/c1-19(2,3)28-18(25)24-12-15(13-24)22-17(20-4)21-11-14-7-9-16(10-8-14)29(26,27)23(5)6/h7-10,15H,11-13H2,1-6H3,(H2,20,21,22) |
| InChIKey | FMKHMJFFTGMPBL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|