C20H31IN6O4 — CID 109466183
tert-butyl 3-[[N-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109466183) has the molecular formula C20H31IN6O4 and a molecular weight of 546.41 g/mol. Its IUPAC name is tert-butyl 3-[[N-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109466183 |
| Molecular Formula | C20H31IN6O4 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | tert-butyl 3-[[N-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)NCC(N)=O)cc1)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C20H30N6O4.HI/c1-20(2,3)30-19(29)26-11-15(12-26)25-18(22-4)24-9-13-5-7-14(8-6-13)17(28)23-10-16(21)27;/h5-8,15H,9-12H2,1-4H3,(H2,21,27)(H,23,28)(H2,22,24,25);1H |
| InChIKey | REEBZGCSOONJEY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|