C18H27IN4O4 — CID 111164644
ethyl 4-[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164644) has the molecular formula C18H27IN4O4 and a molecular weight of 490.34 g/mol. Its IUPAC name is ethyl 4-[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164644 |
| Molecular Formula | C18H27IN4O4 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | ethyl 4-[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCN(/C(=N\C)NCCc2ccc3c(c2)OCO3)CC1.I |
| InChI | InChI=1S/C18H26N4O4.HI/c1-3-24-18(23)22-10-8-21(9-11-22)17(19-2)20-7-6-14-4-5-15-16(12-14)26-13-25-15;/h4-5,12H,3,6-11,13H2,1-2H3,(H,19,20);1H |
| InChIKey | SOWBGGPERLQFKI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|