C19H29NO3 — CID 28633710
3-(3,4-diethoxyphenyl)-1-[(3S)-3-methylpiperidin-1-yl]propan-1-one (PubChem CID 28633710) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-1-[(3S)-3-methylpiperidin-1-yl]propan-1-one.
| Compound Name | 3-(3,4-diethoxyphenyl)-1-[(3S)-3-methylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 28633710 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-1-[(3S)-3-methylpiperidin-1-yl]propan-1-one |
| SMILES | CCOc1ccc(CCC(=O)N2CCC[C@H](C)C2)cc1OCC |
| InChI | InChI=1S/C19H29NO3/c1-4-22-17-10-8-16(13-18(17)23-5-2)9-11-19(21)20-12-6-7-15(3)14-20/h8,10,13,15H,4-7,9,11-12,14H2,1-3H3/t15-/m0/s1 |
| InChIKey | YHPJDIRLBGDVRI-HNNXBMFYSA-N |
| XLogP | 3.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |