C20H28F2N4O4 — CID 111301127
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111301127) has the molecular formula C20H28F2N4O4 and a molecular weight of 426.46 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111301127 |
| Molecular Formula | C20H28F2N4O4 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC(F)F)c1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C20H28F2N4O4/c1-23-20(24-13-14-5-6-15(28-2)17(12-14)30-19(21)22)26-9-7-25(8-10-26)18(27)16-4-3-11-29-16/h5-6,12,16,19H,3-4,7-11,13H2,1-2H3,(H,23,24) |
| InChIKey | SPUMBZHWVJPRPT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|