C20H29N5O4 — CID 111984309
2-[3-[[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenoxy]acetamide (PubChem CID 111984309) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[3-[[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111984309 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 2-[3-[[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]methyl]phenoxy]acetamide |
| SMILES | C/N=C(\NCc1cccc(OCC(N)=O)c1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C20H29N5O4/c1-22-20(23-13-15-4-2-5-16(12-15)29-14-18(21)26)25-9-7-24(8-10-25)19(27)17-6-3-11-28-17/h2,4-5,12,17H,3,6-11,13-14H2,1H3,(H2,21,26)(H,22,23) |
| InChIKey | YCZUNCQJULESKE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|