C21H27IN4O2 — CID 111992470
2-[3-[[[N-methyl-C-(3-phenylpyrrolidin-1-yl)carbonimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111992470) has the molecular formula C21H27IN4O2 and a molecular weight of 494.38 g/mol. Its IUPAC name is 2-[3-[[[N-methyl-C-(3-phenylpyrrolidin-1-yl)carbonimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[N-methyl-C-(3-phenylpyrrolidin-1-yl)carbonimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111992470 |
| Molecular Formula | C21H27IN4O2 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 2-[3-[[[N-methyl-C-(3-phenylpyrrolidin-1-yl)carbonimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCC(N)=O)c1)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C21H26N4O2.HI/c1-23-21(25-11-10-18(14-25)17-7-3-2-4-8-17)24-13-16-6-5-9-19(12-16)27-15-20(22)26;/h2-9,12,18H,10-11,13-15H2,1H3,(H2,22,26)(H,23,24);1H |
| InChIKey | IBSIMXGEAZMPAT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|