C24H31IN4O — CID 111723272
N'-methyl-N-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111723272) has the molecular formula C24H31IN4O and a molecular weight of 518.44 g/mol. Its IUPAC name is N'-methyl-N-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111723272 |
| Molecular Formula | C24H31IN4O |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | N'-methyl-N-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(CN2CCCC2=O)c1)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C24H30N4O.HI/c1-25-24(28-14-12-22(18-28)21-9-3-2-4-10-21)26-16-19-7-5-8-20(15-19)17-27-13-6-11-23(27)29;/h2-5,7-10,15,22H,6,11-14,16-18H2,1H3,(H,25,26);1H |
| InChIKey | OFIYAMCVSLLZLL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|