C26H32N4O — CID 109414747
4-benzylidene-N'-methyl-N-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide (PubChem CID 109414747) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-benzylidene-N'-methyl-N-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N'-methyl-N-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109414747 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 4-benzylidene-N'-methyl-N-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(CN2CCCC2=O)c1)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N4O/c1-27-26(29-15-12-22(13-16-29)17-21-7-3-2-4-8-21)28-19-23-9-5-10-24(18-23)20-30-14-6-11-25(30)31/h2-5,7-10,17-18H,6,11-16,19-20H2,1H3,(H,27,28) |
| InChIKey | SERLBWLCNYPHLB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|