C21H24FN3O — CID 109414828
4-benzylidene-N-[(3-fluoro-4-hydroxyphenyl)methyl]-N'-methylpiperidine-1-carboximidamide (PubChem CID 109414828) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-benzylidene-N-[(3-fluoro-4-hydroxyphenyl)methyl]-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-[(3-fluoro-4-hydroxyphenyl)methyl]-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109414828 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-benzylidene-N-[(3-fluoro-4-hydroxyphenyl)methyl]-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(O)c(F)c1)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24FN3O/c1-23-21(24-15-18-7-8-20(26)19(22)14-18)25-11-9-17(10-12-25)13-16-5-3-2-4-6-16/h2-8,13-14,26H,9-12,15H2,1H3,(H,23,24) |
| InChIKey | FUNLGJUWJYWGTD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|