C22H23FN4 — CID 109414690
4-benzylidene-N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylpiperidine-1-carboximidamide (PubChem CID 109414690) has the molecular formula C22H23FN4 and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-benzylidene-N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109414690 |
| Molecular Formula | C22H23FN4 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 4-benzylidene-N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cc(C#N)ccc1F)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H23FN4/c1-25-22(26-16-20-14-19(15-24)7-8-21(20)23)27-11-9-18(10-12-27)13-17-5-3-2-4-6-17/h2-8,13-14H,9-12,16H2,1H3,(H,25,26) |
| InChIKey | WNLCRKPAUOORHA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|