C16H21F2N3 — CID 109414843
4-benzylidene-N-(2,2-difluoroethyl)-N'-methylpiperidine-1-carboximidamide (PubChem CID 109414843) has the molecular formula C16H21F2N3 and a molecular weight of 293.36 g/mol. Its IUPAC name is 4-benzylidene-N-(2,2-difluoroethyl)-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-(2,2-difluoroethyl)-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109414843 |
| Molecular Formula | C16H21F2N3 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 4-benzylidene-N-(2,2-difluoroethyl)-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC(F)F)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H21F2N3/c1-19-16(20-12-15(17)18)21-9-7-14(8-10-21)11-13-5-3-2-4-6-13/h2-6,11,15H,7-10,12H2,1H3,(H,19,20) |
| InChIKey | JZPAWCNQCHBLTB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|