C18H27N3O2S — CID 109414255
4-benzylidene-N-(2-ethylsulfonylethyl)-N'-methylpiperidine-1-carboximidamide (PubChem CID 109414255) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-benzylidene-N-(2-ethylsulfonylethyl)-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-(2-ethylsulfonylethyl)-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109414255 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-benzylidene-N-(2-ethylsulfonylethyl)-N'-methylpiperidine-1-carboximidamide |
| SMILES | CCS(=O)(=O)CCN/C(=N\C)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O2S/c1-3-24(22,23)14-11-20-18(19-2)21-12-9-17(10-13-21)15-16-7-5-4-6-8-16/h4-8,15H,3,9-14H2,1-2H3,(H,19,20) |
| InChIKey | DQLVMNLORRJDDK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|