C23H30IN3O2S — CID 109414678
4-benzylidene-N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 109414678) has the molecular formula C23H30IN3O2S and a molecular weight of 539.48 g/mol. Its IUPAC name is 4-benzylidene-N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzylidene-N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109414678 |
| Molecular Formula | C23H30IN3O2S |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | 4-benzylidene-N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(S(C)(=O)=O)cc1)N1CCC(=Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H29N3O2S.HI/c1-24-23(25-15-12-19-8-10-22(11-9-19)29(2,27)28)26-16-13-21(14-17-26)18-20-6-4-3-5-7-20;/h3-11,18H,12-17H2,1-2H3,(H,24,25);1H |
| InChIKey | VELUMSZHUCVWER-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|