C22H34N4O3S — CID 109414302
4-benzylidene-N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N'-methylpiperidine-1-carboximidamide (PubChem CID 109414302) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is 4-benzylidene-N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109414302 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 4-benzylidene-N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CC(C)OC(C)C1)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H34N4O3S/c1-18-16-26(17-19(2)29-18)30(27,28)14-11-24-22(23-3)25-12-9-21(10-13-25)15-20-7-5-4-6-8-20/h4-8,15,18-19H,9-14,16-17H2,1-3H3,(H,23,24) |
| InChIKey | BBTWKFZODPFUGC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|