C25H32N4O — CID 109415517
4-benzylidene-N'-methyl-N-[(4-morpholin-4-ylphenyl)methyl]piperidine-1-carboximidamide (PubChem CID 109415517) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is 4-benzylidene-N'-methyl-N-[(4-morpholin-4-ylphenyl)methyl]piperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N'-methyl-N-[(4-morpholin-4-ylphenyl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109415517 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 4-benzylidene-N'-methyl-N-[(4-morpholin-4-ylphenyl)methyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(N2CCOCC2)cc1)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N4O/c1-26-25(29-13-11-22(12-14-29)19-21-5-3-2-4-6-21)27-20-23-7-9-24(10-8-23)28-15-17-30-18-16-28/h2-10,19H,11-18,20H2,1H3,(H,26,27) |
| InChIKey | IMGYDQNUDAWBQR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|