C23H29N3O2 — CID 109415306
4-benzylidene-N-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-N'-methylpiperidine-1-carboximidamide (PubChem CID 109415306) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-benzylidene-N-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109415306 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-benzylidene-N-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(/NCCc1ccc(OC)cc1O)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N3O2/c1-24-23(25-13-10-20-8-9-21(28-2)17-22(20)27)26-14-11-19(12-15-26)16-18-6-4-3-5-7-18/h3-9,16-17,27H,10-15H2,1-2H3,(H,24,25) |
| InChIKey | AVRBAOUASJHWEQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|