C25H32N4O3 — CID 111302941
N'-methyl-4-(oxolane-2-carbonyl)-N-[[3-(phenoxymethyl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 111302941) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is N'-methyl-4-(oxolane-2-carbonyl)-N-[[3-(phenoxymethyl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[[3-(phenoxymethyl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111302941 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[[3-(phenoxymethyl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(COc2ccccc2)c1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C25H32N4O3/c1-26-25(29-14-12-28(13-15-29)24(30)23-11-6-16-31-23)27-18-20-7-5-8-21(17-20)19-32-22-9-3-2-4-10-22/h2-5,7-10,17,23H,6,11-16,18-19H2,1H3,(H,26,27) |
| InChIKey | ZAWQJNRWHXDOMH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|